C11H14ClNS — CID 162716651
3-(3-chlorophenyl)-N,N-dimethylpropanethioamide (PubChem CID 162716651) has the molecular formula C11H14ClNS and a molecular weight of 227.76 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N,N-dimethylpropanethioamide.
| Compound Name | 3-(3-chlorophenyl)-N,N-dimethylpropanethioamide |
|---|---|
| PubChem CID | 162716651 |
| Molecular Formula | C11H14ClNS |
| Molecular Weight | 227.76 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 3-(3-chlorophenyl)-N,N-dimethylpropanethioamide |
| SMILES | CN(C)C(=S)CCc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H14ClNS/c1-13(2)11(14)7-6-9-4-3-5-10(12)8-9/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | UIGGCKONQFQHPQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.76 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|