C15H22ClNO3 — CID 86913073
3-(3-chlorophenyl)-N,N-bis(2-methoxyethyl)propanamide (PubChem CID 86913073) has the molecular formula C15H22ClNO3 and a molecular weight of 299.80 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N,N-bis(2-methoxyethyl)propanamide.
| Compound Name | 3-(3-chlorophenyl)-N,N-bis(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 86913073 |
| Molecular Formula | C15H22ClNO3 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-(3-chlorophenyl)-N,N-bis(2-methoxyethyl)propanamide |
| SMILES | COCCN(CCOC)C(=O)CCc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H22ClNO3/c1-19-10-8-17(9-11-20-2)15(18)7-6-13-4-3-5-14(16)12-13/h3-5,12H,6-11H2,1-2H3 |
| InChIKey | ZABOLTDGAKQAHI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |