C12H17ClN2O3 — CID 110929481
3-(3-chlorophenyl)-1-(2-hydroxyethyl)-1-(2-methoxyethyl)urea (PubChem CID 110929481) has the molecular formula C12H17ClN2O3 and a molecular weight of 272.73 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-(2-hydroxyethyl)-1-(2-methoxyethyl)urea.
| Compound Name | 3-(3-chlorophenyl)-1-(2-hydroxyethyl)-1-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 110929481 |
| Molecular Formula | C12H17ClN2O3 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 3-(3-chlorophenyl)-1-(2-hydroxyethyl)-1-(2-methoxyethyl)urea |
| SMILES | COCCN(CCO)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H17ClN2O3/c1-18-8-6-15(5-7-16)12(17)14-11-4-2-3-10(13)9-11/h2-4,9,16H,5-8H2,1H3,(H,14,17) |
| InChIKey | IFMDOWHDRMXEQF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |