C14H19F3N2O3 — CID 111473504
1-(2-hydroxyethyl)-1-(2-methoxyethyl)-3-[4-methyl-3-(trifluoromethyl)phenyl]urea (PubChem CID 111473504) has the molecular formula C14H19F3N2O3 and a molecular weight of 320.31 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-1-(2-methoxyethyl)-3-[4-methyl-3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(2-hydroxyethyl)-1-(2-methoxyethyl)-3-[4-methyl-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 111473504 |
| Molecular Formula | C14H19F3N2O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-(2-hydroxyethyl)-1-(2-methoxyethyl)-3-[4-methyl-3-(trifluoromethyl)phenyl]urea |
| SMILES | COCCN(CCO)C(=O)Nc1ccc(C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H19F3N2O3/c1-10-3-4-11(9-12(10)14(15,16)17)18-13(21)19(5-7-20)6-8-22-2/h3-4,9,20H,5-8H2,1-2H3,(H,18,21) |
| InChIKey | KPZMVWPXNFVGFZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |