C14H20N2O5 — CID 51324616
3-(1,3-benzodioxol-5-yl)-1,1-bis(2-methoxyethyl)urea (PubChem CID 51324616) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1,1-bis(2-methoxyethyl)urea.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1,1-bis(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 51324616 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1,1-bis(2-methoxyethyl)urea |
| SMILES | COCCN(CCOC)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H20N2O5/c1-18-7-5-16(6-8-19-2)14(17)15-11-3-4-12-13(9-11)21-10-20-12/h3-4,9H,5-8,10H2,1-2H3,(H,15,17) |
| InChIKey | RFLONDMFUCRWOP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |