C13H17N3O5 — CID 108893798
ethyl N-(2-aminoethyl)-N-(1,3-benzodioxol-5-ylcarbamoyl)carbamate (PubChem CID 108893798) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is ethyl N-(2-aminoethyl)-N-(1,3-benzodioxol-5-ylcarbamoyl)carbamate.
| Compound Name | ethyl N-(2-aminoethyl)-N-(1,3-benzodioxol-5-ylcarbamoyl)carbamate |
|---|---|
| PubChem CID | 108893798 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | ethyl N-(2-aminoethyl)-N-(1,3-benzodioxol-5-ylcarbamoyl)carbamate |
| SMILES | CCOC(=O)N(CCN)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H17N3O5/c1-2-19-13(18)16(6-5-14)12(17)15-9-3-4-10-11(7-9)21-8-20-10/h3-4,7H,2,5-6,8,14H2,1H3,(H,15,17) |
| InChIKey | BLEITZNZLALLAN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |