C12H17N3O4 — CID 108871651
ethyl N-(2-aminoethyl)-N-[(2-hydroxyphenyl)carbamoyl]carbamate (PubChem CID 108871651) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is ethyl N-(2-aminoethyl)-N-[(2-hydroxyphenyl)carbamoyl]carbamate.
| Compound Name | ethyl N-(2-aminoethyl)-N-[(2-hydroxyphenyl)carbamoyl]carbamate |
|---|---|
| PubChem CID | 108871651 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | ethyl N-(2-aminoethyl)-N-[(2-hydroxyphenyl)carbamoyl]carbamate |
| SMILES | CCOC(=O)N(CCN)C(=O)Nc1ccccc1O |
| InChI | InChI=1S/C12H17N3O4/c1-2-19-12(18)15(8-7-13)11(17)14-9-5-3-4-6-10(9)16/h3-6,16H,2,7-8,13H2,1H3,(H,14,17) |
| InChIKey | VMJRILHQUTYJOB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|