C17H22N4O5 — CID 108889674
ethyl N-(2-aminoethyl)-N-[3-(1,3-dioxoisoindol-2-yl)propylcarbamoyl]carbamate (PubChem CID 108889674) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is ethyl N-(2-aminoethyl)-N-[3-(1,3-dioxoisoindol-2-yl)propylcarbamoyl]carbamate.
| Compound Name | ethyl N-(2-aminoethyl)-N-[3-(1,3-dioxoisoindol-2-yl)propylcarbamoyl]carbamate |
|---|---|
| PubChem CID | 108889674 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | ethyl N-(2-aminoethyl)-N-[3-(1,3-dioxoisoindol-2-yl)propylcarbamoyl]carbamate |
| SMILES | CCOC(=O)N(CCN)C(=O)NCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H22N4O5/c1-2-26-17(25)21(11-8-18)16(24)19-9-5-10-20-14(22)12-6-3-4-7-13(12)15(20)23/h3-4,6-7H,2,5,8-11,18H2,1H3,(H,19,24) |
| InChIKey | UIVSQGVWSKGCGC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 122.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|