C16H22N4O2 — CID 111810690
1-[4-(1,3-dioxoisoindol-2-yl)butyl]-2-propylguanidine (PubChem CID 111810690) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-[4-(1,3-dioxoisoindol-2-yl)butyl]-2-propylguanidine.
| Compound Name | 1-[4-(1,3-dioxoisoindol-2-yl)butyl]-2-propylguanidine |
|---|---|
| PubChem CID | 111810690 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 1-[4-(1,3-dioxoisoindol-2-yl)butyl]-2-propylguanidine |
| SMILES | CCC/N=C(\N)NCCCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H22N4O2/c1-2-9-18-16(17)19-10-5-6-11-20-14(21)12-7-3-4-8-13(12)15(20)22/h3-4,7-8H,2,5-6,9-11H2,1H3,(H3,17,18,19) |
| InChIKey | HMXIHIQTBJAEBO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|