C21H24N4O2 — CID 111810630
1-(3,4-dimethylphenyl)-2-[4-(1,3-dioxoisoindol-2-yl)butyl]guanidine (PubChem CID 111810630) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-[4-(1,3-dioxoisoindol-2-yl)butyl]guanidine.
| Compound Name | 1-(3,4-dimethylphenyl)-2-[4-(1,3-dioxoisoindol-2-yl)butyl]guanidine |
|---|---|
| PubChem CID | 111810630 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-[4-(1,3-dioxoisoindol-2-yl)butyl]guanidine |
| SMILES | Cc1ccc(N/C(N)=N/CCCCN2C(=O)c3ccccc3C2=O)cc1C |
| InChI | InChI=1S/C21H24N4O2/c1-14-9-10-16(13-15(14)2)24-21(22)23-11-5-6-12-25-19(26)17-7-3-4-8-18(17)20(25)27/h3-4,7-10,13H,5-6,11-12H2,1-2H3,(H3,22,23,24) |
| InChIKey | GXNOVIHVKQCAAT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|