C19H22N4O — CID 119120151
1-(3,4-dimethylphenyl)-2-[2-(2-oxo-3H-indol-1-yl)ethyl]guanidine (PubChem CID 119120151) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-[2-(2-oxo-3H-indol-1-yl)ethyl]guanidine.
| Compound Name | 1-(3,4-dimethylphenyl)-2-[2-(2-oxo-3H-indol-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 119120151 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-[2-(2-oxo-3H-indol-1-yl)ethyl]guanidine |
| SMILES | Cc1ccc(N/C(N)=N/CCN2C(=O)Cc3ccccc32)cc1C |
| InChI | InChI=1S/C19H22N4O/c1-13-7-8-16(11-14(13)2)22-19(20)21-9-10-23-17-6-4-3-5-15(17)12-18(23)24/h3-8,11H,9-10,12H2,1-2H3,(H3,20,21,22) |
| InChIKey | ZILDFCSFUPNBCS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|