C14H22IN3 — CID 111814605
2-(2-cyclopropylethyl)-1-(3,4-dimethylphenyl)guanidine;hydroiodide (PubChem CID 111814605) has the molecular formula C14H22IN3 and a molecular weight of 359.26 g/mol. Its IUPAC name is 2-(2-cyclopropylethyl)-1-(3,4-dimethylphenyl)guanidine;hydroiodide.
| Compound Name | 2-(2-cyclopropylethyl)-1-(3,4-dimethylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111814605 |
| Molecular Formula | C14H22IN3 |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 2-(2-cyclopropylethyl)-1-(3,4-dimethylphenyl)guanidine;hydroiodide |
| SMILES | Cc1ccc(N/C(N)=N/CCC2CC2)cc1C.I |
| InChI | InChI=1S/C14H21N3.HI/c1-10-3-6-13(9-11(10)2)17-14(15)16-8-7-12-4-5-12;/h3,6,9,12H,4-5,7-8H2,1-2H3,(H3,15,16,17);1H |
| InChIKey | LDVVIHFXSJAYFC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|