C15H21N3 — CID 111814632
2-(2-cyclopropylethyl)-1-(2,3-dihydro-1H-inden-5-yl)guanidine (PubChem CID 111814632) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-(2-cyclopropylethyl)-1-(2,3-dihydro-1H-inden-5-yl)guanidine.
| Compound Name | 2-(2-cyclopropylethyl)-1-(2,3-dihydro-1H-inden-5-yl)guanidine |
|---|---|
| PubChem CID | 111814632 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 2-(2-cyclopropylethyl)-1-(2,3-dihydro-1H-inden-5-yl)guanidine |
| SMILES | N/C(=N\CCC1CC1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H21N3/c16-15(17-9-8-11-4-5-11)18-14-7-6-12-2-1-3-13(12)10-14/h6-7,10-11H,1-5,8-9H2,(H3,16,17,18) |
| InChIKey | MKQRITGRYKISSL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|