C14H17N3 — CID 119147795
2-but-3-ynyl-1-(2,3-dihydro-1H-inden-5-yl)guanidine (PubChem CID 119147795) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-but-3-ynyl-1-(2,3-dihydro-1H-inden-5-yl)guanidine.
| Compound Name | 2-but-3-ynyl-1-(2,3-dihydro-1H-inden-5-yl)guanidine |
|---|---|
| PubChem CID | 119147795 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 2-but-3-ynyl-1-(2,3-dihydro-1H-inden-5-yl)guanidine |
| SMILES | C#CCC/N=C(\N)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C14H17N3/c1-2-3-9-16-14(15)17-13-8-7-11-5-4-6-12(11)10-13/h1,7-8,10H,3-6,9H2,(H3,15,16,17) |
| InChIKey | CXRNGALWSJJXIO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|