C18H22IN3S — CID 111033085
1-(2,3-dihydro-1H-inden-5-yl)-2-(2-phenylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111033085) has the molecular formula C18H22IN3S and a molecular weight of 439.37 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-(2-phenylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-(2-phenylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111033085 |
| Molecular Formula | C18H22IN3S |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-(2-phenylsulfanylethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCSc1ccccc1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C18H21N3S.HI/c19-18(20-11-12-22-17-7-2-1-3-8-17)21-16-10-9-14-5-4-6-15(14)13-16;/h1-3,7-10,13H,4-6,11-12H2,(H3,19,20,21);1H |
| InChIKey | HBTSTYWXEHTTDK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|