C17H21N3S — CID 111033070
1-(4-ethylphenyl)-2-(2-phenylsulfanylethyl)guanidine (PubChem CID 111033070) has the molecular formula C17H21N3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2-(2-phenylsulfanylethyl)guanidine.
| Compound Name | 1-(4-ethylphenyl)-2-(2-phenylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111033070 |
| Molecular Formula | C17H21N3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-(4-ethylphenyl)-2-(2-phenylsulfanylethyl)guanidine |
| SMILES | CCc1ccc(N/C(N)=N/CCSc2ccccc2)cc1 |
| InChI | InChI=1S/C17H21N3S/c1-2-14-8-10-15(11-9-14)20-17(18)19-12-13-21-16-6-4-3-5-7-16/h3-11H,2,12-13H2,1H3,(H3,18,19,20) |
| InChIKey | RDKXWLAHVDSEGJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|