C19H24IN3O — CID 111076340
1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(2-methylphenoxy)ethyl]guanidine;hydroiodide (PubChem CID 111076340) has the molecular formula C19H24IN3O and a molecular weight of 437.33 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(2-methylphenoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(2-methylphenoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111076340 |
| Molecular Formula | C19H24IN3O |
| Molecular Weight | 437.33 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[2-(2-methylphenoxy)ethyl]guanidine;hydroiodide |
| SMILES | Cc1ccccc1OCC/N=C(\N)Nc1ccc2c(c1)CCC2.I |
| InChI | InChI=1S/C19H23N3O.HI/c1-14-5-2-3-8-18(14)23-12-11-21-19(20)22-17-10-9-15-6-4-7-16(15)13-17;/h2-3,5,8-10,13H,4,6-7,11-12H2,1H3,(H3,20,21,22);1H |
| InChIKey | CWDCTVYFSAMUCI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|