C18H19F2N3O — CID 111806150
2-[2-(3,4-difluorophenoxy)ethyl]-1-(2,3-dihydro-1H-inden-5-yl)guanidine (PubChem CID 111806150) has the molecular formula C18H19F2N3O and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-[2-(3,4-difluorophenoxy)ethyl]-1-(2,3-dihydro-1H-inden-5-yl)guanidine.
| Compound Name | 2-[2-(3,4-difluorophenoxy)ethyl]-1-(2,3-dihydro-1H-inden-5-yl)guanidine |
|---|---|
| PubChem CID | 111806150 |
| Molecular Formula | C18H19F2N3O |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-[2-(3,4-difluorophenoxy)ethyl]-1-(2,3-dihydro-1H-inden-5-yl)guanidine |
| SMILES | N/C(=N\CCOc1ccc(F)c(F)c1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C18H19F2N3O/c19-16-7-6-15(11-17(16)20)24-9-8-22-18(21)23-14-5-4-12-2-1-3-13(12)10-14/h4-7,10-11H,1-3,8-9H2,(H3,21,22,23) |
| InChIKey | XQXGDKGOCWNMPU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|