C15H21F2N3O — CID 111806172
1-cyclohexyl-2-[2-(3,4-difluorophenoxy)ethyl]guanidine (PubChem CID 111806172) has the molecular formula C15H21F2N3O and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-cyclohexyl-2-[2-(3,4-difluorophenoxy)ethyl]guanidine.
| Compound Name | 1-cyclohexyl-2-[2-(3,4-difluorophenoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 111806172 |
| Molecular Formula | C15H21F2N3O |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-cyclohexyl-2-[2-(3,4-difluorophenoxy)ethyl]guanidine |
| SMILES | N/C(=N\CCOc1ccc(F)c(F)c1)NC1CCCCC1 |
| InChI | InChI=1S/C15H21F2N3O/c16-13-7-6-12(10-14(13)17)21-9-8-19-15(18)20-11-4-2-1-3-5-11/h6-7,10-11H,1-5,8-9H2,(H3,18,19,20) |
| InChIKey | WAESWVZKQGARIP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|