C14H19F2N3 — CID 62369891
1-cyclohexyl-2-[(3,4-difluorophenyl)methyl]guanidine (PubChem CID 62369891) has the molecular formula C14H19F2N3 and a molecular weight of 267.32 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(3,4-difluorophenyl)methyl]guanidine.
| Compound Name | 1-cyclohexyl-2-[(3,4-difluorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 62369891 |
| Molecular Formula | C14H19F2N3 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 1-cyclohexyl-2-[(3,4-difluorophenyl)methyl]guanidine |
| SMILES | N/C(=N\Cc1ccc(F)c(F)c1)NC1CCCCC1 |
| InChI | InChI=1S/C14H19F2N3/c15-12-7-6-10(8-13(12)16)9-18-14(17)19-11-4-2-1-3-5-11/h6-8,11H,1-5,9H2,(H3,17,18,19) |
| InChIKey | FRTKABBDYPTMBO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|