C18H21FN4O — CID 120603148
1-cyclopentyl-2-[[2-(2-fluorophenoxy)-4-pyridinyl]methyl]guanidine (PubChem CID 120603148) has the molecular formula C18H21FN4O and a molecular weight of 328.39 g/mol. Its IUPAC name is 1-cyclopentyl-2-[[2-(2-fluorophenoxy)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-cyclopentyl-2-[[2-(2-fluorophenoxy)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 120603148 |
| Molecular Formula | C18H21FN4O |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 1-cyclopentyl-2-[[2-(2-fluorophenoxy)-4-pyridinyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1ccnc(Oc2ccccc2F)c1)NC1CCCC1 |
| InChI | InChI=1S/C18H21FN4O/c19-15-7-3-4-8-16(15)24-17-11-13(9-10-21-17)12-22-18(20)23-14-5-1-2-6-14/h3-4,7-11,14H,1-2,5-6,12H2,(H3,20,22,23) |
| InChIKey | UDGIRJBVSOYZTC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|