C11H13ClFN3 — CID 62532592
2-[(3-chloro-4-fluorophenyl)methyl]-1-cyclopropylguanidine (PubChem CID 62532592) has the molecular formula C11H13ClFN3 and a molecular weight of 241.70 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methyl]-1-cyclopropylguanidine.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methyl]-1-cyclopropylguanidine |
|---|---|
| PubChem CID | 62532592 |
| Molecular Formula | C11H13ClFN3 |
| Molecular Weight | 241.70 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methyl]-1-cyclopropylguanidine |
| SMILES | N/C(=N\Cc1ccc(F)c(Cl)c1)NC1CC1 |
| InChI | InChI=1S/C11H13ClFN3/c12-9-5-7(1-4-10(9)13)6-15-11(14)16-8-2-3-8/h1,4-5,8H,2-3,6H2,(H3,14,15,16) |
| InChIKey | OCHGGXHNGLTKGQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.70 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|