C11H12BrF2N3 — CID 122081958
2-[(4-bromo-2,6-difluorophenyl)methyl]-1-cyclopropylguanidine (PubChem CID 122081958) has the molecular formula C11H12BrF2N3 and a molecular weight of 304.14 g/mol. Its IUPAC name is 2-[(4-bromo-2,6-difluorophenyl)methyl]-1-cyclopropylguanidine.
| Compound Name | 2-[(4-bromo-2,6-difluorophenyl)methyl]-1-cyclopropylguanidine |
|---|---|
| PubChem CID | 122081958 |
| Molecular Formula | C11H12BrF2N3 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 2-[(4-bromo-2,6-difluorophenyl)methyl]-1-cyclopropylguanidine |
| SMILES | N/C(=N\Cc1c(F)cc(Br)cc1F)NC1CC1 |
| InChI | InChI=1S/C11H12BrF2N3/c12-6-3-9(13)8(10(14)4-6)5-16-11(15)17-7-1-2-7/h3-4,7H,1-2,5H2,(H3,15,16,17) |
| InChIKey | OTURTCBWBNFJHB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|