C9H13N3S — CID 62407822
1-cyclopropyl-2-(thiophen-3-ylmethyl)guanidine (PubChem CID 62407822) has the molecular formula C9H13N3S and a molecular weight of 195.29 g/mol. Its IUPAC name is 1-cyclopropyl-2-(thiophen-3-ylmethyl)guanidine.
| Compound Name | 1-cyclopropyl-2-(thiophen-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 62407822 |
| Molecular Formula | C9H13N3S |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 1-cyclopropyl-2-(thiophen-3-ylmethyl)guanidine |
| SMILES | N/C(=N\Cc1ccsc1)NC1CC1 |
| InChI | InChI=1S/C9H13N3S/c10-9(12-8-1-2-8)11-5-7-3-4-13-6-7/h3-4,6,8H,1-2,5H2,(H3,10,11,12) |
| InChIKey | QFLVSMQRXJMRHH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|