C10H15N3S — CID 78989976
1-cyclopropyl-2-[(3-methylthiophen-2-yl)methyl]guanidine (PubChem CID 78989976) has the molecular formula C10H15N3S and a molecular weight of 209.32 g/mol. Its IUPAC name is 1-cyclopropyl-2-[(3-methylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-cyclopropyl-2-[(3-methylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 78989976 |
| Molecular Formula | C10H15N3S |
| Molecular Weight | 209.32 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1-cyclopropyl-2-[(3-methylthiophen-2-yl)methyl]guanidine |
| SMILES | Cc1ccsc1C/N=C(\N)NC1CC1 |
| InChI | InChI=1S/C10H15N3S/c1-7-4-5-14-9(7)6-12-10(11)13-8-2-3-8/h4-5,8H,2-3,6H2,1H3,(H3,11,12,13) |
| InChIKey | HSPUTRLXPZHKHR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|