C10H14N4 — CID 62362184
1-cyclopropyl-2-(pyridin-4-ylmethyl)guanidine (PubChem CID 62362184) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-cyclopropyl-2-(pyridin-4-ylmethyl)guanidine.
| Compound Name | 1-cyclopropyl-2-(pyridin-4-ylmethyl)guanidine |
|---|---|
| PubChem CID | 62362184 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1-cyclopropyl-2-(pyridin-4-ylmethyl)guanidine |
| SMILES | N/C(=N\Cc1ccncc1)NC1CC1 |
| InChI | InChI=1S/C10H14N4/c11-10(14-9-1-2-9)13-7-8-3-5-12-6-4-8/h3-6,9H,1-2,7H2,(H3,11,13,14) |
| InChIKey | KWEPFURERGZOLV-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|