C14H16ClN3S — CID 122082640
2-[(5-chloro-3-methyl-1-benzothiophen-2-yl)methyl]-1-cyclopropylguanidine (PubChem CID 122082640) has the molecular formula C14H16ClN3S and a molecular weight of 293.82 g/mol. Its IUPAC name is 2-[(5-chloro-3-methyl-1-benzothiophen-2-yl)methyl]-1-cyclopropylguanidine.
| Compound Name | 2-[(5-chloro-3-methyl-1-benzothiophen-2-yl)methyl]-1-cyclopropylguanidine |
|---|---|
| PubChem CID | 122082640 |
| Molecular Formula | C14H16ClN3S |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-[(5-chloro-3-methyl-1-benzothiophen-2-yl)methyl]-1-cyclopropylguanidine |
| SMILES | Cc1c(C/N=C(\N)NC2CC2)sc2ccc(Cl)cc12 |
| InChI | InChI=1S/C14H16ClN3S/c1-8-11-6-9(15)2-5-12(11)19-13(8)7-17-14(16)18-10-3-4-10/h2,5-6,10H,3-4,7H2,1H3,(H3,16,17,18) |
| InChIKey | YGKYKCSJUXIAAF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|