C14H21N3O2S2 — CID 119150873
1-cyclopropyl-3-[(1,1-dioxothiolan-3-yl)methyl]-2-(thiophen-3-ylmethyl)guanidine (PubChem CID 119150873) has the molecular formula C14H21N3O2S2 and a molecular weight of 327.48 g/mol. Its IUPAC name is 1-cyclopropyl-3-[(1,1-dioxothiolan-3-yl)methyl]-2-(thiophen-3-ylmethyl)guanidine.
| Compound Name | 1-cyclopropyl-3-[(1,1-dioxothiolan-3-yl)methyl]-2-(thiophen-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 119150873 |
| Molecular Formula | C14H21N3O2S2 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 1-cyclopropyl-3-[(1,1-dioxothiolan-3-yl)methyl]-2-(thiophen-3-ylmethyl)guanidine |
| SMILES | O=S1(=O)CCC(CN/C(=N\Cc2ccsc2)NC2CC2)C1 |
| InChI | InChI=1S/C14H21N3O2S2/c18-21(19)6-4-12(10-21)8-16-14(17-13-1-2-13)15-7-11-3-5-20-9-11/h3,5,9,12-13H,1-2,4,6-8,10H2,(H2,15,16,17) |
| InChIKey | CYDUNAFPQPLEMR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|