C16H26IN3O3S — CID 119139258
1-cyclopentyl-3-[(1,1-dioxothiolan-3-yl)methyl]-2-(furan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 119139258) has the molecular formula C16H26IN3O3S and a molecular weight of 467.37 g/mol. Its IUPAC name is 1-cyclopentyl-3-[(1,1-dioxothiolan-3-yl)methyl]-2-(furan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-cyclopentyl-3-[(1,1-dioxothiolan-3-yl)methyl]-2-(furan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119139258 |
| Molecular Formula | C16H26IN3O3S |
| Molecular Weight | 467.37 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | 1-cyclopentyl-3-[(1,1-dioxothiolan-3-yl)methyl]-2-(furan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | I.O=S1(=O)CCC(CN/C(=N\Cc2ccco2)NC2CCCC2)C1 |
| InChI | InChI=1S/C16H25N3O3S.HI/c20-23(21)9-7-13(12-23)10-17-16(19-14-4-1-2-5-14)18-11-15-6-3-8-22-15;/h3,6,8,13-14H,1-2,4-5,7,9-12H2,(H2,17,18,19);1H |
| InChIKey | ZMCGIYWJPQSNLY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|