C17H23N3O4S — CID 119148888
2-(1,3-benzodioxol-5-ylmethyl)-1-cyclopropyl-3-[(1,1-dioxothiolan-3-yl)methyl]guanidine (PubChem CID 119148888) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-cyclopropyl-3-[(1,1-dioxothiolan-3-yl)methyl]guanidine.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-cyclopropyl-3-[(1,1-dioxothiolan-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 119148888 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-cyclopropyl-3-[(1,1-dioxothiolan-3-yl)methyl]guanidine |
| SMILES | O=S1(=O)CCC(CN/C(=N\Cc2ccc3c(c2)OCO3)NC2CC2)C1 |
| InChI | InChI=1S/C17H23N3O4S/c21-25(22)6-5-13(10-25)9-19-17(20-14-2-3-14)18-8-12-1-4-15-16(7-12)24-11-23-15/h1,4,7,13-14H,2-3,5-6,8-11H2,(H2,18,19,20) |
| InChIKey | HWMTXKMCZVUMSR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|