C24H30N4O4 — CID 134108635
1-[[3-(aminomethyl)cyclohexyl]methyl]-3-(1,3-benzodioxol-5-yl)-2-(1,3-benzodioxol-5-ylmethyl)guanidine (PubChem CID 134108635) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 1-[[3-(aminomethyl)cyclohexyl]methyl]-3-(1,3-benzodioxol-5-yl)-2-(1,3-benzodioxol-5-ylmethyl)guanidine.
| Compound Name | 1-[[3-(aminomethyl)cyclohexyl]methyl]-3-(1,3-benzodioxol-5-yl)-2-(1,3-benzodioxol-5-ylmethyl)guanidine |
|---|---|
| PubChem CID | 134108635 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 1-[[3-(aminomethyl)cyclohexyl]methyl]-3-(1,3-benzodioxol-5-yl)-2-(1,3-benzodioxol-5-ylmethyl)guanidine |
| SMILES | NCC1CCCC(CN/C(=N\Cc2ccc3c(c2)OCO3)Nc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C24H30N4O4/c25-11-16-2-1-3-17(8-16)12-26-24(28-19-5-7-21-23(10-19)32-15-30-21)27-13-18-4-6-20-22(9-18)31-14-29-20/h4-7,9-10,16-17H,1-3,8,11-15,25H2,(H2,26,27,28) |
| InChIKey | NNMCNMVSQAQLMV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|