C25H39N5O2 — CID 134108641
N'-[[3-(aminomethyl)cyclohexyl]methyl]-N-(1,3-benzodioxol-5-yl)-4-pyrrolidin-1-ylpiperidine-1-carboximidamide (PubChem CID 134108641) has the molecular formula C25H39N5O2 and a molecular weight of 441.62 g/mol. Its IUPAC name is N'-[[3-(aminomethyl)cyclohexyl]methyl]-N-(1,3-benzodioxol-5-yl)-4-pyrrolidin-1-ylpiperidine-1-carboximidamide.
| Compound Name | N'-[[3-(aminomethyl)cyclohexyl]methyl]-N-(1,3-benzodioxol-5-yl)-4-pyrrolidin-1-ylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 134108641 |
| Molecular Formula | C25H39N5O2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | N'-[[3-(aminomethyl)cyclohexyl]methyl]-N-(1,3-benzodioxol-5-yl)-4-pyrrolidin-1-ylpiperidine-1-carboximidamide |
| SMILES | NCC1CCCC(C/N=C(/Nc2ccc3c(c2)OCO3)N2CCC(N3CCCC3)CC2)C1 |
| InChI | InChI=1S/C25H39N5O2/c26-16-19-4-3-5-20(14-19)17-27-25(28-21-6-7-23-24(15-21)32-18-31-23)30-12-8-22(9-13-30)29-10-1-2-11-29/h6-7,15,19-20,22H,1-5,8-14,16-18,26H2,(H,27,28) |
| InChIKey | UCVXOWBZOASIBL-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|