C15H22N4O3 — CID 134088763
1-(2-aminoethyl)-3-(1,3-benzodioxol-5-yl)-2-(oxolan-2-ylmethyl)guanidine (PubChem CID 134088763) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-(1,3-benzodioxol-5-yl)-2-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 1-(2-aminoethyl)-3-(1,3-benzodioxol-5-yl)-2-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 134088763 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 1-(2-aminoethyl)-3-(1,3-benzodioxol-5-yl)-2-(oxolan-2-ylmethyl)guanidine |
| SMILES | NCCN/C(=N\CC1CCCO1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H22N4O3/c16-5-6-17-15(18-9-12-2-1-7-20-12)19-11-3-4-13-14(8-11)22-10-21-13/h3-4,8,12H,1-2,5-7,9-10,16H2,(H2,17,18,19) |
| InChIKey | FGQRVWPPDNPWJS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|