C16H25N5O3 — CID 134088793
N'-(2-aminoethyl)-N-(1,3-benzodioxol-5-yl)-4-(2-hydroxyethyl)piperazine-1-carboximidamide (PubChem CID 134088793) has the molecular formula C16H25N5O3 and a molecular weight of 335.41 g/mol. Its IUPAC name is N'-(2-aminoethyl)-N-(1,3-benzodioxol-5-yl)-4-(2-hydroxyethyl)piperazine-1-carboximidamide.
| Compound Name | N'-(2-aminoethyl)-N-(1,3-benzodioxol-5-yl)-4-(2-hydroxyethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 134088793 |
| Molecular Formula | C16H25N5O3 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | N'-(2-aminoethyl)-N-(1,3-benzodioxol-5-yl)-4-(2-hydroxyethyl)piperazine-1-carboximidamide |
| SMILES | NCC/N=C(/Nc1ccc2c(c1)OCO2)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C16H25N5O3/c17-3-4-18-16(21-7-5-20(6-8-21)9-10-22)19-13-1-2-14-15(11-13)24-12-23-14/h1-2,11,22H,3-10,12,17H2,(H,18,19) |
| InChIKey | AZRGDYPGCFUHCG-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|