C21H34FN5O — CID 134091967
N'-[[3-(aminomethyl)cyclohexyl]methyl]-N-(3-fluorophenyl)-4-(2-hydroxyethyl)piperazine-1-carboximidamide (PubChem CID 134091967) has the molecular formula C21H34FN5O and a molecular weight of 391.54 g/mol. Its IUPAC name is N'-[[3-(aminomethyl)cyclohexyl]methyl]-N-(3-fluorophenyl)-4-(2-hydroxyethyl)piperazine-1-carboximidamide.
| Compound Name | N'-[[3-(aminomethyl)cyclohexyl]methyl]-N-(3-fluorophenyl)-4-(2-hydroxyethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 134091967 |
| Molecular Formula | C21H34FN5O |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | N'-[[3-(aminomethyl)cyclohexyl]methyl]-N-(3-fluorophenyl)-4-(2-hydroxyethyl)piperazine-1-carboximidamide |
| SMILES | NCC1CCCC(C/N=C(/Nc2cccc(F)c2)N2CCN(CCO)CC2)C1 |
| InChI | InChI=1S/C21H34FN5O/c22-19-5-2-6-20(14-19)25-21(27-9-7-26(8-10-27)11-12-28)24-16-18-4-1-3-17(13-18)15-23/h2,5-6,14,17-18,28H,1,3-4,7-13,15-16,23H2,(H,24,25) |
| InChIKey | FUKNGRIQHHOWFM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|