C14H21FN4O — CID 63631483
1-[1-(2-aminoethyl)piperidin-4-yl]-3-(3-fluorophenyl)urea (PubChem CID 63631483) has the molecular formula C14H21FN4O and a molecular weight of 280.35 g/mol. Its IUPAC name is 1-[1-(2-aminoethyl)piperidin-4-yl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[1-(2-aminoethyl)piperidin-4-yl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 63631483 |
| Molecular Formula | C14H21FN4O |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1-[1-(2-aminoethyl)piperidin-4-yl]-3-(3-fluorophenyl)urea |
| SMILES | NCCN1CCC(NC(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C14H21FN4O/c15-11-2-1-3-13(10-11)18-14(20)17-12-4-7-19(8-5-12)9-6-16/h1-3,10,12H,4-9,16H2,(H2,17,18,20) |
| InChIKey | YEQQYIUTSHXCPE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |