C15H20FN3O — CID 61150447
1-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-3-(3-fluorophenyl)urea (PubChem CID 61150447) has the molecular formula C15H20FN3O and a molecular weight of 277.34 g/mol. Its IUPAC name is 1-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 61150447 |
| Molecular Formula | C15H20FN3O |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 1-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-3-(3-fluorophenyl)urea |
| SMILES | O=C(Nc1cccc(F)c1)NC1CC[C@H]2CNC[C@H]2C1 |
| InChI | InChI=1S/C15H20FN3O/c16-12-2-1-3-13(7-12)18-15(20)19-14-5-4-10-8-17-9-11(10)6-14/h1-3,7,10-11,14,17H,4-6,8-9H2,(H2,18,19,20)/t10-,11+,14?/m0/s1 |
| InChIKey | LIJPTQCDKPOJGA-VJDHTCGKSA-N |
| XLogP | 2.34 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |