C14H17FN2O — CID 98779497
(1R,5R)-N-(3-fluorophenyl)-3-azabicyclo[3.2.1]octane-8-carboxamide (PubChem CID 98779497) has the molecular formula C14H17FN2O and a molecular weight of 248.30 g/mol. Its IUPAC name is (1R,5R)-N-(3-fluorophenyl)-3-azabicyclo[3.2.1]octane-8-carboxamide.
| Compound Name | (1R,5R)-N-(3-fluorophenyl)-3-azabicyclo[3.2.1]octane-8-carboxamide |
|---|---|
| PubChem CID | 98779497 |
| Molecular Formula | C14H17FN2O |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | (1R,5R)-N-(3-fluorophenyl)-3-azabicyclo[3.2.1]octane-8-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)C1[C@H]2CC[C@H]1CNC2 |
| InChI | InChI=1S/C14H17FN2O/c15-11-2-1-3-12(6-11)17-14(18)13-9-4-5-10(13)8-16-7-9/h1-3,6,9-10,13,16H,4-5,7-8H2,(H,17,18)/t9-,10-/m0/s1 |
| InChIKey | JQCUGXFFWMSVLO-UWVGGRQHSA-N |
| XLogP | 2.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |