C17H23ClN4O2 — CID 120657031
1-[3-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]phenyl]-3-cyclopropylurea;hydrochloride (PubChem CID 120657031) has the molecular formula C17H23ClN4O2 and a molecular weight of 350.85 g/mol. Its IUPAC name is 1-[3-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]phenyl]-3-cyclopropylurea;hydrochloride.
| Compound Name | 1-[3-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]phenyl]-3-cyclopropylurea;hydrochloride |
|---|---|
| PubChem CID | 120657031 |
| Molecular Formula | C17H23ClN4O2 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 1-[3-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]phenyl]-3-cyclopropylurea;hydrochloride |
| SMILES | Cl.O=C(Nc1cccc(C(=O)N2C[C@H]3CNC[C@H]3C2)c1)NC1CC1 |
| InChI | InChI=1S/C17H22N4O2.ClH/c22-16(21-9-12-7-18-8-13(12)10-21)11-2-1-3-15(6-11)20-17(23)19-14-4-5-14;/h1-3,6,12-14,18H,4-5,7-10H2,(H2,19,20,23);1H/t12-,13+; |
| InChIKey | CEKAPNVXIDOXRJ-OEEJBDNKSA-N |
| XLogP | 1.68 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |