C18H24ClN3O2 — CID 120655838
N-[3-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]phenyl]-2-methylcyclopropane-1-carboxamide;hydrochloride (PubChem CID 120655838) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is N-[3-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]phenyl]-2-methylcyclopropane-1-carboxamide;hydrochloride.
| Compound Name | N-[3-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]phenyl]-2-methylcyclopropane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120655838 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N-[3-[(3aS,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carbonyl]phenyl]-2-methylcyclopropane-1-carboxamide;hydrochloride |
| SMILES | CC1CC1C(=O)Nc1cccc(C(=O)N2C[C@H]3CNC[C@H]3C2)c1.Cl |
| InChI | InChI=1S/C18H23N3O2.ClH/c1-11-5-16(11)17(22)20-15-4-2-3-12(6-15)18(23)21-9-13-7-19-8-14(13)10-21;/h2-4,6,11,13-14,16,19H,5,7-10H2,1H3,(H,20,22);1H/t11?,13-,14+,16?; |
| InChIKey | QFAWCAZJOJVFKC-ZDONSCFWSA-N |
| XLogP | 1.99 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |