C21H23N3O2 — CID 136521438
1-[3-(3-benzylazetidine-1-carbonyl)phenyl]-3-cyclopropylurea (PubChem CID 136521438) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 1-[3-(3-benzylazetidine-1-carbonyl)phenyl]-3-cyclopropylurea.
| Compound Name | 1-[3-(3-benzylazetidine-1-carbonyl)phenyl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 136521438 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 1-[3-(3-benzylazetidine-1-carbonyl)phenyl]-3-cyclopropylurea |
| SMILES | O=C(Nc1cccc(C(=O)N2CC(Cc3ccccc3)C2)c1)NC1CC1 |
| InChI | InChI=1S/C21H23N3O2/c25-20(24-13-16(14-24)11-15-5-2-1-3-6-15)17-7-4-8-19(12-17)23-21(26)22-18-9-10-18/h1-8,12,16,18H,9-11,13-14H2,(H2,22,23,26) |
| InChIKey | UIJXWTOWEQPPFO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |