C15H18F2N2O — CID 43603814
N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-2,4-difluorobenzamide (PubChem CID 43603814) has the molecular formula C15H18F2N2O and a molecular weight of 280.32 g/mol. Its IUPAC name is N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-2,4-difluorobenzamide.
| Compound Name | N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 43603814 |
| Molecular Formula | C15H18F2N2O |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-2,4-difluorobenzamide |
| SMILES | O=C(NC1CC[C@H]2CNC[C@H]2C1)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H18F2N2O/c16-11-2-4-13(14(17)6-11)15(20)19-12-3-1-9-7-18-8-10(9)5-12/h2,4,6,9-10,12,18H,1,3,5,7-8H2,(H,19,20)/t9-,10+,12?/m0/s1 |
| InChIKey | KGILVPDBATYCJP-YPBKCWQDSA-N |
| XLogP | 2.08 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |