C15H22N2O2 — CID 43603808
N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 43603808) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 43603808 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC2CC[C@H]3CNC[C@H]3C2)c(C)o1 |
| InChI | InChI=1S/C15H22N2O2/c1-9-5-14(10(2)19-9)15(18)17-13-4-3-11-7-16-8-12(11)6-13/h5,11-13,16H,3-4,6-8H2,1-2H3,(H,17,18)/t11-,12+,13?/m0/s1 |
| InChIKey | VJTNVBRDJLBHIT-LAGVYOHYSA-N |
| XLogP | 2.01 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |