C16H22N2O2 — CID 107675666
N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-4-hydroxy-3-methylbenzamide (PubChem CID 107675666) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-4-hydroxy-3-methylbenzamide.
| Compound Name | N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-4-hydroxy-3-methylbenzamide |
|---|---|
| PubChem CID | 107675666 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-[(3aS,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindol-5-yl]-4-hydroxy-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NC2CC[C@H]3CNC[C@H]3C2)ccc1O |
| InChI | InChI=1S/C16H22N2O2/c1-10-6-11(3-5-15(10)19)16(20)18-14-4-2-12-8-17-9-13(12)7-14/h3,5-6,12-14,17,19H,2,4,7-9H2,1H3,(H,18,20)/t12-,13+,14?/m0/s1 |
| InChIKey | NTIQNPWAQFKWAR-WLDKUNSKSA-N |
| XLogP | 1.82 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |