C17H25NO2 — CID 107676630
4-hydroxy-3-methyl-N-(4-propylcyclohexyl)benzamide (PubChem CID 107676630) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 4-hydroxy-3-methyl-N-(4-propylcyclohexyl)benzamide.
| Compound Name | 4-hydroxy-3-methyl-N-(4-propylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 107676630 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 4-hydroxy-3-methyl-N-(4-propylcyclohexyl)benzamide |
| SMILES | CCCC1CCC(NC(=O)c2ccc(O)c(C)c2)CC1 |
| InChI | InChI=1S/C17H25NO2/c1-3-4-13-5-8-15(9-6-13)18-17(20)14-7-10-16(19)12(2)11-14/h7,10-11,13,15,19H,3-6,8-9H2,1-2H3,(H,18,20) |
| InChIKey | ZLVOHUIVLGDTFJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |