C16H22ClNO — CID 10612734
4-chloro-N-(4-propylcyclohexyl)benzamide (PubChem CID 10612734) has the molecular formula C16H22ClNO and a molecular weight of 279.81 g/mol. Its IUPAC name is 4-chloro-N-(4-propylcyclohexyl)benzamide.
| Compound Name | 4-chloro-N-(4-propylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 10612734 |
| Molecular Formula | C16H22ClNO |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 4-chloro-N-(4-propylcyclohexyl)benzamide |
| SMILES | CCCC1CCC(NC(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H22ClNO/c1-2-3-12-4-10-15(11-5-12)18-16(19)13-6-8-14(17)9-7-13/h6-9,12,15H,2-5,10-11H2,1H3,(H,18,19) |
| InChIKey | HNFQYMZHTUCSMX-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |