C18H27NO2 — CID 107676803
4-hydroxy-3-methyl-N-(3,3,5,5-tetramethylcyclohexyl)benzamide (PubChem CID 107676803) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 4-hydroxy-3-methyl-N-(3,3,5,5-tetramethylcyclohexyl)benzamide.
| Compound Name | 4-hydroxy-3-methyl-N-(3,3,5,5-tetramethylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 107676803 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 4-hydroxy-3-methyl-N-(3,3,5,5-tetramethylcyclohexyl)benzamide |
| SMILES | Cc1cc(C(=O)NC2CC(C)(C)CC(C)(C)C2)ccc1O |
| InChI | InChI=1S/C18H27NO2/c1-12-8-13(6-7-15(12)20)16(21)19-14-9-17(2,3)11-18(4,5)10-14/h6-8,14,20H,9-11H2,1-5H3,(H,19,21) |
| InChIKey | KWUWZWWTAHTFMM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |