C17H26N4O2S — CID 74232170
2-[3-[[1-(2-methylsulfanylethyl)piperidin-4-yl]carbamoylamino]phenyl]acetamide (PubChem CID 74232170) has the molecular formula C17H26N4O2S and a molecular weight of 350.49 g/mol. Its IUPAC name is 2-[3-[[1-(2-methylsulfanylethyl)piperidin-4-yl]carbamoylamino]phenyl]acetamide.
| Compound Name | 2-[3-[[1-(2-methylsulfanylethyl)piperidin-4-yl]carbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 74232170 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-[3-[[1-(2-methylsulfanylethyl)piperidin-4-yl]carbamoylamino]phenyl]acetamide |
| SMILES | CSCCN1CCC(NC(=O)Nc2cccc(CC(N)=O)c2)CC1 |
| InChI | InChI=1S/C17H26N4O2S/c1-24-10-9-21-7-5-14(6-8-21)19-17(23)20-15-4-2-3-13(11-15)12-16(18)22/h2-4,11,14H,5-10,12H2,1H3,(H2,18,22)(H2,19,20,23) |
| InChIKey | SKOQPNBBYHJLBV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |