C18H28N4O2S — CID 86986489
2-[4-[(3-methylsulfanylphenyl)carbamoylamino]piperidin-1-yl]-N-propylacetamide (PubChem CID 86986489) has the molecular formula C18H28N4O2S and a molecular weight of 364.52 g/mol. Its IUPAC name is 2-[4-[(3-methylsulfanylphenyl)carbamoylamino]piperidin-1-yl]-N-propylacetamide.
| Compound Name | 2-[4-[(3-methylsulfanylphenyl)carbamoylamino]piperidin-1-yl]-N-propylacetamide |
|---|---|
| PubChem CID | 86986489 |
| Molecular Formula | C18H28N4O2S |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 2-[4-[(3-methylsulfanylphenyl)carbamoylamino]piperidin-1-yl]-N-propylacetamide |
| SMILES | CCCNC(=O)CN1CCC(NC(=O)Nc2cccc(SC)c2)CC1 |
| InChI | InChI=1S/C18H28N4O2S/c1-3-9-19-17(23)13-22-10-7-14(8-11-22)20-18(24)21-15-5-4-6-16(12-15)25-2/h4-6,12,14H,3,7-11,13H2,1-2H3,(H,19,23)(H2,20,21,24) |
| InChIKey | PZKLFZTVSRTEEV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |