C15H20N2O3S — CID 61183412
4-[(3-methylsulfanylphenyl)carbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 61183412) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 4-[(3-methylsulfanylphenyl)carbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3-methylsulfanylphenyl)carbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 61183412 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 4-[(3-methylsulfanylphenyl)carbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | CSc1cccc(NC(=O)NC2CCC(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C15H20N2O3S/c1-21-13-4-2-3-12(9-13)17-15(20)16-11-7-5-10(6-8-11)14(18)19/h2-4,9-11H,5-8H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | AGPPMQGEPBXAMM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |